C20H14I2N2O2 — CID 2852267
1-N,2-N-bis(4-iodophenyl)benzene-1,2-dicarboxamide (PubChem CID 2852267) has the molecular formula C20H14I2N2O2 and a molecular weight of 568.15 g/mol. Its IUPAC name is 1-N,2-N-bis(4-iodophenyl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis(4-iodophenyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 2852267 |
| Molecular Formula | C20H14I2N2O2 |
| Molecular Weight | 568.15 g/mol |
| Exact Mass | 567.91 |
| IUPAC Name | 1-N,2-N-bis(4-iodophenyl)benzene-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1ccccc1C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C20H14I2N2O2/c21-13-5-9-15(10-6-13)23-19(25)17-3-1-2-4-18(17)20(26)24-16-11-7-14(22)8-12-16/h1-12H,(H,23,25)(H,24,26) |
| InChIKey | PNHNSLIWCCFVAR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.15 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|