About (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone
(2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone (PubChem CID 114939814) has the molecular formula C19H15NO
and a molecular weight of 273.34 g/mol. Its IUPAC name is (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone.
Molecular Properties
| Compound Name | (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone |
| PubChem CID | 114939814 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone |
| SMILES | Nc1ccccc1C(=O)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H15NO/c20-17-7-2-1-5-16(17)19(21)15-11-10-13-9-8-12-4-3-6-14(15)18(12)13/h1-7,10-11H,8-9,20H2 |
| InChIKey | YXXNYCBAUDNRIS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone?
The IUPAC name of (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone (CID 114939814) is (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone.
What is the SMILES notation for (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone?
The canonical SMILES for (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone is Nc1ccccc1C(=O)c1ccc2c3c(cccc13)CC2.
What is the InChIKey of (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone?
The InChIKey is YXXNYCBAUDNRIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO/c20-17-7-2-1-5-16(17)19(21)15-11-10-13-9-8-12-4-3-6-14(15)18(12)13/h1-7,10-11H,8-9,20H2.
What are the key properties of (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone?
(2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone has a molecular weight of 273.34 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl)-(1,2-dihydroacenaphthylen-5-yl)methanone is sourced from PubChem (CID 114939814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).