C18H15N — CID 114939446
2-(1,2-dihydroacenaphthylen-5-yl)aniline (PubChem CID 114939446) has the molecular formula C18H15N and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(1,2-dihydroacenaphthylen-5-yl)aniline.
| Compound Name | 2-(1,2-dihydroacenaphthylen-5-yl)aniline |
|---|---|
| PubChem CID | 114939446 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-(1,2-dihydroacenaphthylen-5-yl)aniline |
| SMILES | Nc1ccccc1-c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C18H15N/c19-17-7-2-1-5-15(17)14-11-10-13-9-8-12-4-3-6-16(14)18(12)13/h1-7,10-11H,8-9,19H2 |
| InChIKey | YBIBZJPZPSKCIW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|