C21H20O3 — CID 122402189
5-(2,3,4-trimethoxyphenyl)-1,2-dihydroacenaphthylene (PubChem CID 122402189) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-(2,3,4-trimethoxyphenyl)-1,2-dihydroacenaphthylene.
| Compound Name | 5-(2,3,4-trimethoxyphenyl)-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 122402189 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 5-(2,3,4-trimethoxyphenyl)-1,2-dihydroacenaphthylene |
| SMILES | COc1ccc(-c2ccc3c4c(cccc24)CC3)c(OC)c1OC |
| InChI | InChI=1S/C21H20O3/c1-22-18-12-11-17(20(23-2)21(18)24-3)15-10-9-14-8-7-13-5-4-6-16(15)19(13)14/h4-6,9-12H,7-8H2,1-3H3 |
| InChIKey | DKWIFBALVFTQGQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |