C18H13NO — CID 138698486
2-dibenzofuran-1-ylaniline (PubChem CID 138698486) has the molecular formula C18H13NO and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-dibenzofuran-1-ylaniline.
| Compound Name | 2-dibenzofuran-1-ylaniline |
|---|---|
| PubChem CID | 138698486 |
| Molecular Formula | C18H13NO |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-dibenzofuran-1-ylaniline |
| SMILES | Nc1ccccc1-c1cccc2oc3ccccc3c12 |
| InChI | InChI=1S/C18H13NO/c19-15-9-3-1-6-12(15)13-8-5-11-17-18(13)14-7-2-4-10-16(14)20-17/h1-11H,19H2 |
| InChIKey | JGHAHJGAOGIUQC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|