About 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid
5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid (PubChem CID 100820577) has the molecular formula C19H15NO5S
and a molecular weight of 369.40 g/mol. Its IUPAC name is 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid |
| PubChem CID | 100820577 |
| Molecular Formula | C19H15NO5S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccc3c4c(cccc24)CC3)ccc1O |
| InChI | InChI=1S/C19H15NO5S/c21-16-8-7-13(10-15(16)19(22)23)20-26(24,25)17-9-6-12-5-4-11-2-1-3-14(17)18(11)12/h1-3,6-10,20-21H,4-5H2,(H,22,23) |
| InChIKey | WKYNQYLDVAWUAZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid?
The IUPAC name of 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid (CID 100820577) is 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid.
What is the SMILES notation for 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid?
The canonical SMILES for 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid is O=C(O)c1cc(NS(=O)(=O)c2ccc3c4c(cccc24)CC3)ccc1O.
What is the InChIKey of 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid?
The InChIKey is WKYNQYLDVAWUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO5S/c21-16-8-7-13(10-15(16)19(22)23)20-26(24,25)17-9-6-12-5-4-11-2-1-3-14(17)18(11)12/h1-3,6-10,20-21H,4-5H2,(H,22,23).
What are the key properties of 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid?
5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid has a molecular weight of 369.40 g/mol, XLogP of 3.14, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-2-hydroxybenzoic acid is sourced from PubChem (CID 100820577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).