C15H14BrNO6S — CID 167824562
5-[(5-bromo-2-methoxy-4-methylphenyl)sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 167824562) has the molecular formula C15H14BrNO6S and a molecular weight of 416.25 g/mol. Its IUPAC name is 5-[(5-bromo-2-methoxy-4-methylphenyl)sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(5-bromo-2-methoxy-4-methylphenyl)sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 167824562 |
| Molecular Formula | C15H14BrNO6S |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 5-[(5-bromo-2-methoxy-4-methylphenyl)sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | COc1cc(C)c(Br)cc1S(=O)(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H14BrNO6S/c1-8-5-13(23-2)14(7-11(8)16)24(21,22)17-9-3-4-12(18)10(6-9)15(19)20/h3-7,17-18H,1-2H3,(H,19,20) |
| InChIKey | AWBBNVLVRXXOFZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|