C20H18N2O6S — CID 175181066
4-[[5-(3-aminophenyl)-2-methoxyphenyl]sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 175181066) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is 4-[[5-(3-aminophenyl)-2-methoxyphenyl]sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[5-(3-aminophenyl)-2-methoxyphenyl]sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 175181066 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 4-[[5-(3-aminophenyl)-2-methoxyphenyl]sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(-c2cccc(N)c2)cc1S(=O)(=O)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C20H18N2O6S/c1-28-18-8-5-13(12-3-2-4-14(21)9-12)10-19(18)29(26,27)22-15-6-7-16(20(24)25)17(23)11-15/h2-11,22-23H,21H2,1H3,(H,24,25) |
| InChIKey | JILHJDKQVKLEBT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|