C21H17N3O3S — CID 166397295
5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-1H-indole-2-carboxamide (PubChem CID 166397295) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-1H-indole-2-carboxamide.
| Compound Name | 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166397295 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 5-(1,2-dihydroacenaphthylen-5-ylsulfonylamino)-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1cc2cc(NS(=O)(=O)c3ccc4c5c(cccc35)CC4)ccc2[nH]1 |
| InChI | InChI=1S/C21H17N3O3S/c22-21(25)18-11-14-10-15(7-8-17(14)23-18)24-28(26,27)19-9-6-13-5-4-12-2-1-3-16(19)20(12)13/h1-3,6-11,23-24H,4-5H2,(H2,22,25) |
| InChIKey | FEARZAUMOBIUER-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |