C18H16FN3O5S — CID 166221418
methyl 4-fluoro-2-[[2-(methylcarbamoyl)-1H-indol-5-yl]sulfamoyl]benzoate (PubChem CID 166221418) has the molecular formula C18H16FN3O5S and a molecular weight of 405.41 g/mol. Its IUPAC name is methyl 4-fluoro-2-[[2-(methylcarbamoyl)-1H-indol-5-yl]sulfamoyl]benzoate.
| Compound Name | methyl 4-fluoro-2-[[2-(methylcarbamoyl)-1H-indol-5-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 166221418 |
| Molecular Formula | C18H16FN3O5S |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | methyl 4-fluoro-2-[[2-(methylcarbamoyl)-1H-indol-5-yl]sulfamoyl]benzoate |
| SMILES | CNC(=O)c1cc2cc(NS(=O)(=O)c3cc(F)ccc3C(=O)OC)ccc2[nH]1 |
| InChI | InChI=1S/C18H16FN3O5S/c1-20-17(23)15-8-10-7-12(4-6-14(10)21-15)22-28(25,26)16-9-11(19)3-5-13(16)18(24)27-2/h3-9,21-22H,1-2H3,(H,20,23) |
| InChIKey | CKYNRDTWXRPJNL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |