C14H12FN5O — CID 154798871
5-[(6-fluoropyrimidin-4-yl)amino]-N-methyl-1H-indole-2-carboxamide (PubChem CID 154798871) has the molecular formula C14H12FN5O and a molecular weight of 285.28 g/mol. Its IUPAC name is 5-[(6-fluoropyrimidin-4-yl)amino]-N-methyl-1H-indole-2-carboxamide.
| Compound Name | 5-[(6-fluoropyrimidin-4-yl)amino]-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 154798871 |
| Molecular Formula | C14H12FN5O |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 5-[(6-fluoropyrimidin-4-yl)amino]-N-methyl-1H-indole-2-carboxamide |
| SMILES | CNC(=O)c1cc2cc(Nc3cc(F)ncn3)ccc2[nH]1 |
| InChI | InChI=1S/C14H12FN5O/c1-16-14(21)11-5-8-4-9(2-3-10(8)20-11)19-13-6-12(15)17-7-18-13/h2-7,20H,1H3,(H,16,21)(H,17,18,19) |
| InChIKey | NKBBZAWJNXTLQX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |