C14H16FN3O2 — CID 115416312
N-(3,4-diethoxyphenyl)-6-fluoropyrimidin-4-amine (PubChem CID 115416312) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-6-fluoropyrimidin-4-amine.
| Compound Name | N-(3,4-diethoxyphenyl)-6-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 115416312 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-6-fluoropyrimidin-4-amine |
| SMILES | CCOc1ccc(Nc2cc(F)ncn2)cc1OCC |
| InChI | InChI=1S/C14H16FN3O2/c1-3-19-11-6-5-10(7-12(11)20-4-2)18-14-8-13(15)16-9-17-14/h5-9H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | ZSBILERKCUNKQA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |