C15H19N3O2 — CID 104532247
5-N-(3,4-diethoxyphenyl)pyridine-3,5-diamine (PubChem CID 104532247) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-N-(3,4-diethoxyphenyl)pyridine-3,5-diamine.
| Compound Name | 5-N-(3,4-diethoxyphenyl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532247 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-N-(3,4-diethoxyphenyl)pyridine-3,5-diamine |
| SMILES | CCOc1ccc(Nc2cncc(N)c2)cc1OCC |
| InChI | InChI=1S/C15H19N3O2/c1-3-19-14-6-5-12(8-15(14)20-4-2)18-13-7-11(16)9-17-10-13/h5-10,18H,3-4,16H2,1-2H3 |
| InChIKey | POVUJCGWYKAQLT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |