C12H14BrN3O2S — CID 64624289
5-bromo-N-(3,4-diethoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 64624289) has the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. Its IUPAC name is 5-bromo-N-(3,4-diethoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-bromo-N-(3,4-diethoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 64624289 |
| Molecular Formula | C12H14BrN3O2S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 5-bromo-N-(3,4-diethoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCOc1ccc(Nc2nnc(Br)s2)cc1OCC |
| InChI | InChI=1S/C12H14BrN3O2S/c1-3-17-9-6-5-8(7-10(9)18-4-2)14-12-16-15-11(13)19-12/h5-7H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | YPUILRSJQDXRFC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |