C13H16N4O3 — CID 20995208
5-(3,4-diethoxyanilino)-2H-1,2,4-triazin-3-one (PubChem CID 20995208) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-(3,4-diethoxyanilino)-2H-1,2,4-triazin-3-one.
| Compound Name | 5-(3,4-diethoxyanilino)-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 20995208 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 5-(3,4-diethoxyanilino)-2H-1,2,4-triazin-3-one |
| SMILES | CCOc1ccc(Nc2cn[nH]c(=O)n2)cc1OCC |
| InChI | InChI=1S/C13H16N4O3/c1-3-19-10-6-5-9(7-11(10)20-4-2)15-12-8-14-17-13(18)16-12/h5-8H,3-4H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | NZCMCOIBAQAAQL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |