C11H12N4O2 — CID 22694039
5-(2-ethoxyanilino)-2H-1,2,4-triazin-3-one (PubChem CID 22694039) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 5-(2-ethoxyanilino)-2H-1,2,4-triazin-3-one.
| Compound Name | 5-(2-ethoxyanilino)-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 22694039 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-(2-ethoxyanilino)-2H-1,2,4-triazin-3-one |
| SMILES | CCOc1ccccc1Nc1cn[nH]c(=O)n1 |
| InChI | InChI=1S/C11H12N4O2/c1-2-17-9-6-4-3-5-8(9)13-10-7-12-15-11(16)14-10/h3-7H,2H2,1H3,(H2,13,14,15,16) |
| InChIKey | XPUXEVFCLQBLGI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |