C11H15N3O — CID 114399974
N-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 114399974) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 114399974 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CCOc1ccccc1NC1=NCCN1 |
| InChI | InChI=1S/C11H15N3O/c1-2-15-10-6-4-3-5-9(10)14-11-12-7-8-13-11/h3-6H,2,7-8H2,1H3,(H2,12,13,14) |
| InChIKey | XLNYHQKVVDEURA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |