C9H10FN3 — CID 5242373
N-(2-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 5242373) has the molecular formula C9H10FN3 and a molecular weight of 179.20 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(2-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 5242373 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-(2-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | Fc1ccccc1NC1=NCCN1 |
| InChI | InChI=1S/C9H10FN3/c10-7-3-1-2-4-8(7)13-9-11-5-6-12-9/h1-4H,5-6H2,(H2,11,12,13) |
| InChIKey | UFOSJTCDONLQMQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |