C11H17N3 — CID 90984879
ethane;N-phenyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 90984879) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is ethane;N-phenyl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | ethane;N-phenyl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 90984879 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | ethane;N-phenyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC.c1ccc(NC2=NCCN2)cc1 |
| InChI | InChI=1S/C9H11N3.C2H6/c1-2-4-8(5-3-1)12-9-10-6-7-11-9;1-2/h1-5H,6-7H2,(H2,10,11,12);1-2H3 |
| InChIKey | TXJRKEIXDCBOQV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |