C15H13N3S — CID 22024188
N-dibenzothiophen-2-yl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 22024188) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is N-dibenzothiophen-2-yl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-dibenzothiophen-2-yl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 22024188 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-dibenzothiophen-2-yl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | c1ccc2c(c1)sc1ccc(NC3=NCCN3)cc12 |
| InChI | InChI=1S/C15H13N3S/c1-2-4-13-11(3-1)12-9-10(5-6-14(12)19-13)18-15-16-7-8-17-15/h1-6,9H,7-8H2,(H2,16,17,18) |
| InChIKey | JTJDTFYDXWNRJS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |