C10H12BrN3 — CID 114400222
N-(3-bromo-4-methylphenyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 114400222) has the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(3-bromo-4-methylphenyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 114400222 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | Cc1ccc(NC2=NCCN2)cc1Br |
| InChI | InChI=1S/C10H12BrN3/c1-7-2-3-8(6-9(7)11)14-10-12-4-5-13-10/h2-3,6H,4-5H2,1H3,(H2,12,13,14) |
| InChIKey | ROPPBSZVYQYZHH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |