C14H15BrN2 — CID 117027243
4-N-(3-bromo-4-methylphenyl)-1-N-methylbenzene-1,4-diamine (PubChem CID 117027243) has the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. Its IUPAC name is 4-N-(3-bromo-4-methylphenyl)-1-N-methylbenzene-1,4-diamine.
| Compound Name | 4-N-(3-bromo-4-methylphenyl)-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 117027243 |
| Molecular Formula | C14H15BrN2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-N-(3-bromo-4-methylphenyl)-1-N-methylbenzene-1,4-diamine |
| SMILES | CNc1ccc(Nc2ccc(C)c(Br)c2)cc1 |
| InChI | InChI=1S/C14H15BrN2/c1-10-3-4-13(9-14(10)15)17-12-7-5-11(16-2)6-8-12/h3-9,16-17H,1-2H3 |
| InChIKey | MZPGARPMWXNHNF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|