C9H11ClN4 — CID 125427077
2-chloro-3-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diamine (PubChem CID 125427077) has the molecular formula C9H11ClN4 and a molecular weight of 210.67 g/mol. Its IUPAC name is 2-chloro-3-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diamine.
| Compound Name | 2-chloro-3-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 125427077 |
| Molecular Formula | C9H11ClN4 |
| Molecular Weight | 210.67 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-chloro-3-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,3-diamine |
| SMILES | Nc1cccc(NC2=NCCN2)c1Cl |
| InChI | InChI=1S/C9H11ClN4/c10-8-6(11)2-1-3-7(8)14-9-12-4-5-13-9/h1-3H,4-5,11H2,(H2,12,13,14) |
| InChIKey | SKHHMOCDFPWRBN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.67 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|