C9H10ClFN4 — CID 139945187
4-chloro-3-N-(4,5-dihydro-1H-imidazol-2-yl)-6-fluorobenzene-1,3-diamine (PubChem CID 139945187) has the molecular formula C9H10ClFN4 and a molecular weight of 228.66 g/mol. Its IUPAC name is 4-chloro-3-N-(4,5-dihydro-1H-imidazol-2-yl)-6-fluorobenzene-1,3-diamine.
| Compound Name | 4-chloro-3-N-(4,5-dihydro-1H-imidazol-2-yl)-6-fluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 139945187 |
| Molecular Formula | C9H10ClFN4 |
| Molecular Weight | 228.66 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 4-chloro-3-N-(4,5-dihydro-1H-imidazol-2-yl)-6-fluorobenzene-1,3-diamine |
| SMILES | Nc1cc(NC2=NCCN2)c(Cl)cc1F |
| InChI | InChI=1S/C9H10ClFN4/c10-5-3-6(11)7(12)4-8(5)15-9-13-1-2-14-9/h3-4H,1-2,12H2,(H2,13,14,15) |
| InChIKey | MRLDBJSTDJNJKM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.66 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|