C9H13Cl2N4O4P — CID 155256199
2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine;phosphoric acid (PubChem CID 155256199) has the molecular formula C9H13Cl2N4O4P and a molecular weight of 343.11 g/mol. Its IUPAC name is 2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine;phosphoric acid.
| Compound Name | 2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine;phosphoric acid |
|---|---|
| PubChem CID | 155256199 |
| Molecular Formula | C9H13Cl2N4O4P |
| Molecular Weight | 343.11 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine;phosphoric acid |
| SMILES | Nc1cc(Cl)c(NC2=NCCN2)c(Cl)c1.O=P(O)(O)O |
| InChI | InChI=1S/C9H10Cl2N4.H3O4P/c10-6-3-5(12)4-7(11)8(6)15-9-13-1-2-14-9;1-5(2,3)4/h3-4H,1-2,12H2,(H2,13,14,15);(H3,1,2,3,4) |
| InChIKey | IVHUHQDIBDUOMN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.11 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|