C18H20Cl4N8 — CID 138491779
2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine (PubChem CID 138491779) has the molecular formula C18H20Cl4N8 and a molecular weight of 490.23 g/mol. Its IUPAC name is 2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 138491779 |
| Molecular Formula | C18H20Cl4N8 |
| Molecular Weight | 490.23 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(NC2=NCCN2)c(Cl)c1.Nc1cc(Cl)c(NC2=NCCN2)c(Cl)c1 |
| InChI | InChI=1S/2C9H10Cl2N4/c2*10-6-3-5(12)4-7(11)8(6)15-9-13-1-2-14-9/h2*3-4H,1-2,12H2,(H2,13,14,15) |
| InChIKey | BBEONIHNRIRQMM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|