C17H18Cl4N8 — CID 87731251
2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine;2-[(E)-(2,6-dichlorophenyl)methylideneamino]guanidine (PubChem CID 87731251) has the molecular formula C17H18Cl4N8 and a molecular weight of 476.20 g/mol. Its IUPAC name is 2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine;2-[(E)-(2,6-dichlorophenyl)methylideneamino]guanidine.
| Compound Name | 2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine;2-[(E)-(2,6-dichlorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 87731251 |
| Molecular Formula | C17H18Cl4N8 |
| Molecular Weight | 476.20 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 2,6-dichloro-1-N-(4,5-dihydro-1H-imidazol-2-yl)benzene-1,4-diamine;2-[(E)-(2,6-dichlorophenyl)methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1c(Cl)cccc1Cl.Nc1cc(Cl)c(NC2=NCCN2)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N4.C8H8Cl2N4/c10-6-3-5(12)4-7(11)8(6)15-9-13-1-2-14-9;9-6-2-1-3-7(10)5(6)4-13-14-8(11)12/h3-4H,1-2,12H2,(H2,13,14,15);1-4H,(H4,11,12,14)/b;13-4+ |
| InChIKey | GXQBAKKFTXMEFY-XCWXIADUSA-N |
| XLogP | 3.55 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|