About 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine
5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine (PubChem CID 3086326) has the molecular formula C11H10ClN5
and a molecular weight of 247.69 g/mol. Its IUPAC name is 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine.
Molecular Properties
| Compound Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine |
| PubChem CID | 3086326 |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine |
| SMILES | Clc1c(NC2=NCCN2)ccc2nccnc12 |
| InChI | InChI=1S/C11H10ClN5/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8/h1-4H,5-6H2,(H2,15,16,17) |
| InChIKey | VJQWCCBDYLTRPZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine?
The IUPAC name of 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine (CID 3086326) is 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine.
What is the SMILES notation for 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine?
The canonical SMILES for 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine is Clc1c(NC2=NCCN2)ccc2nccnc12.
What is the InChIKey of 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine?
The InChIKey is VJQWCCBDYLTRPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN5/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8/h1-4H,5-6H2,(H2,15,16,17).
What are the key properties of 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine?
5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine has a molecular weight of 247.69 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine is sourced from PubChem (CID 3086326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).