C11H10ClN5 — CID 3086326
5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine (PubChem CID 3086326) has the molecular formula C11H10ClN5 and a molecular weight of 247.69 g/mol. Its IUPAC name is 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine.
| Compound Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 3086326 |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine |
| SMILES | Clc1c(NC2=NCCN2)ccc2nccnc12 |
| InChI | InChI=1S/C11H10ClN5/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8/h1-4H,5-6H2,(H2,15,16,17) |
| InChIKey | VJQWCCBDYLTRPZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |