C15H18ClN3O — CID 65028591
N-[3-(chloromethyl)-4-ethoxyphenyl]-6-ethylpyrimidin-4-amine (PubChem CID 65028591) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is N-[3-(chloromethyl)-4-ethoxyphenyl]-6-ethylpyrimidin-4-amine.
| Compound Name | N-[3-(chloromethyl)-4-ethoxyphenyl]-6-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 65028591 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[3-(chloromethyl)-4-ethoxyphenyl]-6-ethylpyrimidin-4-amine |
| SMILES | CCOc1ccc(Nc2cc(CC)ncn2)cc1CCl |
| InChI | InChI=1S/C15H18ClN3O/c1-3-12-8-15(18-10-17-12)19-13-5-6-14(20-4-2)11(7-13)9-16/h5-8,10H,3-4,9H2,1-2H3,(H,17,18,19) |
| InChIKey | ZPALJMDPKVKPFO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|