C12H14ClN3OS — CID 65272748
N-[3-(chloromethyl)-4-ethoxyphenyl]-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 65272748) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is N-[3-(chloromethyl)-4-ethoxyphenyl]-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[3-(chloromethyl)-4-ethoxyphenyl]-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65272748 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | N-[3-(chloromethyl)-4-ethoxyphenyl]-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCOc1ccc(Nc2nc(C)ns2)cc1CCl |
| InChI | InChI=1S/C12H14ClN3OS/c1-3-17-11-5-4-10(6-9(11)7-13)15-12-14-8(2)16-18-12/h4-6H,3,7H2,1-2H3,(H,14,15,16) |
| InChIKey | QGCOBLLOTKZNRY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|