C10H11N3S — CID 130007374
3-methyl-N-(4-methylphenyl)-1,2,4-thiadiazol-5-amine (PubChem CID 130007374) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 3-methyl-N-(4-methylphenyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-methyl-N-(4-methylphenyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 130007374 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-methyl-N-(4-methylphenyl)-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1ccc(Nc2nc(C)ns2)cc1 |
| InChI | InChI=1S/C10H11N3S/c1-7-3-5-9(6-4-7)12-10-11-8(2)13-14-10/h3-6H,1-2H3,(H,11,12,13) |
| InChIKey | IGCFKYFHRNGDMC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |