C19H16FN5O2 — CID 46179432
N-(4-fluorophenyl)-6-[4-(methylcarbamoyl)anilino]pyrimidine-4-carboxamide (PubChem CID 46179432) has the molecular formula C19H16FN5O2 and a molecular weight of 365.37 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-[4-(methylcarbamoyl)anilino]pyrimidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-6-[4-(methylcarbamoyl)anilino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 46179432 |
| Molecular Formula | C19H16FN5O2 |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(4-fluorophenyl)-6-[4-(methylcarbamoyl)anilino]pyrimidine-4-carboxamide |
| SMILES | CNC(=O)c1ccc(Nc2cc(C(=O)Nc3ccc(F)cc3)ncn2)cc1 |
| InChI | InChI=1S/C19H16FN5O2/c1-21-18(26)12-2-6-14(7-3-12)24-17-10-16(22-11-23-17)19(27)25-15-8-4-13(20)5-9-15/h2-11H,1H3,(H,21,26)(H,25,27)(H,22,23,24) |
| InChIKey | JYISWTDLROTMHN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |