C15H17FN4O — CID 109353761
6-(tert-butylamino)-N-(4-fluorophenyl)pyrimidine-4-carboxamide (PubChem CID 109353761) has the molecular formula C15H17FN4O and a molecular weight of 288.33 g/mol. Its IUPAC name is 6-(tert-butylamino)-N-(4-fluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(tert-butylamino)-N-(4-fluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109353761 |
| Molecular Formula | C15H17FN4O |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 6-(tert-butylamino)-N-(4-fluorophenyl)pyrimidine-4-carboxamide |
| SMILES | CC(C)(C)Nc1cc(C(=O)Nc2ccc(F)cc2)ncn1 |
| InChI | InChI=1S/C15H17FN4O/c1-15(2,3)20-13-8-12(17-9-18-13)14(21)19-11-6-4-10(16)5-7-11/h4-9H,1-3H3,(H,19,21)(H,17,18,20) |
| InChIKey | XVRJDIWMDWFKHP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |