C19H17FN4O3 — CID 109357948
N-(3,4-dimethoxyphenyl)-6-(4-fluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109357948) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-6-(4-fluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-6-(4-fluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109357948 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-6-(4-fluoroanilino)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(Nc3ccc(F)cc3)ncn2)cc1OC |
| InChI | InChI=1S/C19H17FN4O3/c1-26-16-8-7-14(9-17(16)27-2)24-19(25)15-10-18(22-11-21-15)23-13-5-3-12(20)4-6-13/h3-11H,1-2H3,(H,24,25)(H,21,22,23) |
| InChIKey | PCXIABDUONDLTD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |