C17H12ClFN4O — CID 109357928
N-(3-chlorophenyl)-6-(4-fluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109357928) has the molecular formula C17H12ClFN4O and a molecular weight of 342.76 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-(4-fluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-6-(4-fluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109357928 |
| Molecular Formula | C17H12ClFN4O |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(3-chlorophenyl)-6-(4-fluoroanilino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cc(Nc2ccc(F)cc2)ncn1 |
| InChI | InChI=1S/C17H12ClFN4O/c18-11-2-1-3-14(8-11)23-17(24)15-9-16(21-10-20-15)22-13-6-4-12(19)5-7-13/h1-10H,(H,23,24)(H,20,21,22) |
| InChIKey | DJQRQDULPFBRDK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |