C19H18FN3O5S — CID 166227197
methyl 2-fluoro-4-methyl-5-[[2-(methylcarbamoyl)-1H-indol-5-yl]sulfamoyl]benzoate (PubChem CID 166227197) has the molecular formula C19H18FN3O5S and a molecular weight of 419.43 g/mol. Its IUPAC name is methyl 2-fluoro-4-methyl-5-[[2-(methylcarbamoyl)-1H-indol-5-yl]sulfamoyl]benzoate.
| Compound Name | methyl 2-fluoro-4-methyl-5-[[2-(methylcarbamoyl)-1H-indol-5-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 166227197 |
| Molecular Formula | C19H18FN3O5S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | methyl 2-fluoro-4-methyl-5-[[2-(methylcarbamoyl)-1H-indol-5-yl]sulfamoyl]benzoate |
| SMILES | CNC(=O)c1cc2cc(NS(=O)(=O)c3cc(C(=O)OC)c(F)cc3C)ccc2[nH]1 |
| InChI | InChI=1S/C19H18FN3O5S/c1-10-6-14(20)13(19(25)28-3)9-17(10)29(26,27)23-12-4-5-15-11(7-12)8-16(22-15)18(24)21-2/h4-9,22-23H,1-3H3,(H,21,24) |
| InChIKey | ITTYGDSQTUOUFL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |