C14H9F4NO4S — CID 31808073
methyl 5-[(2,4-difluorophenyl)sulfonylamino]-2,4-difluorobenzoate (PubChem CID 31808073) has the molecular formula C14H9F4NO4S and a molecular weight of 363.29 g/mol. Its IUPAC name is methyl 5-[(2,4-difluorophenyl)sulfonylamino]-2,4-difluorobenzoate.
| Compound Name | methyl 5-[(2,4-difluorophenyl)sulfonylamino]-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 31808073 |
| Molecular Formula | C14H9F4NO4S |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | methyl 5-[(2,4-difluorophenyl)sulfonylamino]-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2ccc(F)cc2F)c(F)cc1F |
| InChI | InChI=1S/C14H9F4NO4S/c1-23-14(20)8-5-12(10(17)6-9(8)16)19-24(21,22)13-3-2-7(15)4-11(13)18/h2-6,19H,1H3 |
| InChIKey | LNMNCVFMMBRINC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |