C14H9BrF3NO4S — CID 86957052
methyl 2-bromo-5-[(2,4-difluorophenyl)sulfamoyl]-4-fluorobenzoate (PubChem CID 86957052) has the molecular formula C14H9BrF3NO4S and a molecular weight of 424.19 g/mol. Its IUPAC name is methyl 2-bromo-5-[(2,4-difluorophenyl)sulfamoyl]-4-fluorobenzoate.
| Compound Name | methyl 2-bromo-5-[(2,4-difluorophenyl)sulfamoyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 86957052 |
| Molecular Formula | C14H9BrF3NO4S |
| Molecular Weight | 424.19 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | methyl 2-bromo-5-[(2,4-difluorophenyl)sulfamoyl]-4-fluorobenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)Nc2ccc(F)cc2F)c(F)cc1Br |
| InChI | InChI=1S/C14H9BrF3NO4S/c1-23-14(20)8-5-13(11(18)6-9(8)15)24(21,22)19-12-3-2-7(16)4-10(12)17/h2-6,19H,1H3 |
| InChIKey | MUVMOTWMOFPQKD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |