C14H10F2N2O7S — CID 31808177
methyl 2,4-difluoro-5-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoate (PubChem CID 31808177) has the molecular formula C14H10F2N2O7S and a molecular weight of 388.30 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | methyl 2,4-difluoro-5-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 31808177 |
| Molecular Formula | C14H10F2N2O7S |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | methyl 2,4-difluoro-5-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2ccc(O)c([N+](=O)[O-])c2)c(F)cc1F |
| InChI | InChI=1S/C14H10F2N2O7S/c1-25-14(20)8-5-11(10(16)6-9(8)15)17-26(23,24)7-2-3-13(19)12(4-7)18(21)22/h2-6,17,19H,1H3 |
| InChIKey | HIDREAAGWCSLEZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|