C17H18N2O8S — CID 4824340
methyl 4,5-dimethoxy-2-[(4-methyl-3-nitrophenyl)sulfonylamino]benzoate (PubChem CID 4824340) has the molecular formula C17H18N2O8S and a molecular weight of 410.40 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[(4-methyl-3-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[(4-methyl-3-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4824340 |
| Molecular Formula | C17H18N2O8S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[(4-methyl-3-nitrophenyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18N2O8S/c1-10-5-6-11(7-14(10)19(21)22)28(23,24)18-13-9-16(26-3)15(25-2)8-12(13)17(20)27-4/h5-9,18H,1-4H3 |
| InChIKey | ZTBPWQJJRZNUDO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|