C21H21N3O8S2 — CID 2947742
N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 2947742) has the molecular formula C21H21N3O8S2 and a molecular weight of 507.55 g/mol. Its IUPAC name is N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2947742 |
| Molecular Formula | C21H21N3O8S2 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NS(=O)(=O)c3ccc(C)c([N+](=O)[O-])c3)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H21N3O8S2/c1-14-4-8-18(13-20(14)24(25)26)34(29,30)22-15-5-9-17(10-6-15)33(27,28)23-19-11-7-16(31-2)12-21(19)32-3/h4-13,22-23H,1-3H3 |
| InChIKey | MKORVUDQPKOBFL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|