C17H20N2O6S — CID 9190468
N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 9190468) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9190468 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(OC)c([C@H](C)NS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C17H20N2O6S/c1-11-5-7-14(10-16(11)19(20)21)26(22,23)18-12(2)15-9-13(24-3)6-8-17(15)25-4/h5-10,12,18H,1-4H3/t12-/m0/s1 |
| InChIKey | QAZDYPNQNFQVHU-LBPRGKRZSA-N |
| XLogP | 2.96 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|