C17H21NO6S2 — CID 133219385
N-[1-(2,5-dimethoxyphenyl)ethyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 133219385) has the molecular formula C17H21NO6S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 133219385 |
| Molecular Formula | C17H21NO6S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | COc1ccc(OC)c(C(C)NS(=O)(=O)c2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C17H21NO6S2/c1-12(16-11-13(23-2)5-10-17(16)24-3)18-26(21,22)15-8-6-14(7-9-15)25(4,19)20/h5-12,18H,1-4H3 |
| InChIKey | KLNZZYJOQHOKDM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |