C15H14N2O7S — CID 71878117
4-methoxy-3-[(4-methyl-3-nitrophenyl)sulfonylamino]benzoic acid (PubChem CID 71878117) has the molecular formula C15H14N2O7S and a molecular weight of 366.35 g/mol. Its IUPAC name is 4-methoxy-3-[(4-methyl-3-nitrophenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-methoxy-3-[(4-methyl-3-nitrophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 71878117 |
| Molecular Formula | C15H14N2O7S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 4-methoxy-3-[(4-methyl-3-nitrophenyl)sulfonylamino]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N2O7S/c1-9-3-5-11(8-13(9)17(20)21)25(22,23)16-12-7-10(15(18)19)4-6-14(12)24-2/h3-8,16H,1-2H3,(H,18,19) |
| InChIKey | ZEKAACLQUHAPFG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|