C25H27N3O8S — CID 24980139
N-methyl-4-[(4-methyl-3-nitrophenyl)sulfonylamino]-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide (PubChem CID 24980139) has the molecular formula C25H27N3O8S and a molecular weight of 529.57 g/mol. Its IUPAC name is N-methyl-4-[(4-methyl-3-nitrophenyl)sulfonylamino]-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide.
| Compound Name | N-methyl-4-[(4-methyl-3-nitrophenyl)sulfonylamino]-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 24980139 |
| Molecular Formula | C25H27N3O8S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | N-methyl-4-[(4-methyl-3-nitrophenyl)sulfonylamino]-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CN(C)C(=O)c2ccc(NS(=O)(=O)c3ccc(C)c([N+](=O)[O-])c3)cc2)c(OC)c1OC |
| InChI | InChI=1S/C25H27N3O8S/c1-16-6-12-20(14-21(16)28(30)31)37(32,33)26-19-10-7-17(8-11-19)25(29)27(2)15-18-9-13-22(34-3)24(36-5)23(18)35-4/h6-14,26H,15H2,1-5H3 |
| InChIKey | ZMCKNGVVNCLQFC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|