C17H17ClN2O9S — CID 24580523
2-[(4-chloro-3-nitrophenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid (PubChem CID 24580523) has the molecular formula C17H17ClN2O9S and a molecular weight of 460.85 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 24580523 |
| Molecular Formula | C17H17ClN2O9S |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid |
| SMILES | COCCOc1cc(NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C17H17ClN2O9S/c1-27-5-6-29-16-9-13(11(17(21)22)8-15(16)28-2)19-30(25,26)10-3-4-12(18)14(7-10)20(23)24/h3-4,7-9,19H,5-6H2,1-2H3,(H,21,22) |
| InChIKey | YUMXZLDLOFWHQP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|