C19H21Cl2NO7S — CID 24580568
2-[(2,5-dichloro-3,6-dimethylphenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid (PubChem CID 24580568) has the molecular formula C19H21Cl2NO7S and a molecular weight of 478.35 g/mol. Its IUPAC name is 2-[(2,5-dichloro-3,6-dimethylphenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid.
| Compound Name | 2-[(2,5-dichloro-3,6-dimethylphenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 24580568 |
| Molecular Formula | C19H21Cl2NO7S |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 2-[(2,5-dichloro-3,6-dimethylphenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid |
| SMILES | COCCOc1cc(NS(=O)(=O)c2c(C)c(Cl)cc(C)c2Cl)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C19H21Cl2NO7S/c1-10-7-13(20)11(2)18(17(10)21)30(25,26)22-14-9-16(29-6-5-27-3)15(28-4)8-12(14)19(23)24/h7-9,22H,5-6H2,1-4H3,(H,23,24) |
| InChIKey | UBFFZFOPBMJIIJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|