C18H27NO7 — CID 141326742
2-(2,2-dimethylpropanoylamino)-4,5-bis(2-methoxyethoxy)benzoic acid (PubChem CID 141326742) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-4,5-bis(2-methoxyethoxy)benzoic acid.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-4,5-bis(2-methoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 141326742 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-4,5-bis(2-methoxyethoxy)benzoic acid |
| SMILES | COCCOc1cc(NC(=O)C(C)(C)C)c(C(=O)O)cc1OCCOC |
| InChI | InChI=1S/C18H27NO7/c1-18(2,3)17(22)19-13-11-15(26-9-7-24-5)14(25-8-6-23-4)10-12(13)16(20)21/h10-11H,6-9H2,1-5H3,(H,19,22)(H,20,21) |
| InChIKey | DBGLNPLKWUJMKE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|