C11H12N2O3S — CID 175836307
N-methyl-5-methylsulfonyl-1H-indole-2-carboxamide (PubChem CID 175836307) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is N-methyl-5-methylsulfonyl-1H-indole-2-carboxamide.
| Compound Name | N-methyl-5-methylsulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175836307 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | N-methyl-5-methylsulfonyl-1H-indole-2-carboxamide |
| SMILES | CNC(=O)c1cc2cc(S(C)(=O)=O)ccc2[nH]1 |
| InChI | InChI=1S/C11H12N2O3S/c1-12-11(14)10-6-7-5-8(17(2,15)16)3-4-9(7)13-10/h3-6,13H,1-2H3,(H,12,14) |
| InChIKey | GEDJNQHWDXQEAX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |