C18H16N4O3S — CID 166221463
5-[(2-cyano-3-methylphenyl)sulfonylamino]-N-methyl-1H-indole-2-carboxamide (PubChem CID 166221463) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 5-[(2-cyano-3-methylphenyl)sulfonylamino]-N-methyl-1H-indole-2-carboxamide.
| Compound Name | 5-[(2-cyano-3-methylphenyl)sulfonylamino]-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166221463 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 5-[(2-cyano-3-methylphenyl)sulfonylamino]-N-methyl-1H-indole-2-carboxamide |
| SMILES | CNC(=O)c1cc2cc(NS(=O)(=O)c3cccc(C)c3C#N)ccc2[nH]1 |
| InChI | InChI=1S/C18H16N4O3S/c1-11-4-3-5-17(14(11)10-19)26(24,25)22-13-6-7-15-12(8-13)9-16(21-15)18(23)20-2/h3-9,21-22H,1-2H3,(H,20,23) |
| InChIKey | LHLZJJGWHAPMFN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |